Preferred Name |
fluvoxamine |
|
Synonyms |
(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-1-one O-(2-aminoethyl)oxime Fluvoxamine 2-{[(E)-{5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethan-1-amine fluvoxamine O-(2-aminoethyl)-N-{(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}hydroxylamine fluvoxamina fluvoxaminum |
|
Definitions |
An oxime O-ether that is benzene substituted by a (1E)-N-(2-aminoethoxy)-5-methoxypentanimidoyl group at position 1 and a trifluoromethyl group at position 4. It is a selective serotonin reuptake inhibitor that is used for the treatment of obsessive-compulsive disorder. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5138 |
|
charge |
0 |
|
database_cross_reference |
PMID:12107854 MetaCyc:CPD-20520 CAS:54739-18-3 PMID:22859721 PMID:18976545 DrugBank:DB00176 PDBeChem:FVX PMID:33180097 PMID:32618683 PMID:29379174 Chemspider:4481878 PMID:20025739 PMID:31807753 PMID:20573265 PMID:31807102 PMID:33392622 KEGG:D07984 KEGG:C07571 Drug_Central:1230 PMID:7988100 PMID:15686112 Patent:NL7503310 PMID:30690950 HMDB:HMDB0014322 PMID:30734885 PMID:24121440 PMID:32672818 Wikipedia:Fluvoxamine PMID:10456487 PMID:9164424 Beilstein:5583954 PMID:11825104 PMID:16316311 Patent:US4085225 |
|
definition |
An oxime O-ether that is benzene substituted by a (1E)-N-(2-aminoethoxy)-5-methoxypentanimidoyl group at position 1 and a trifluoromethyl group at position 4. It is a selective serotonin reuptake inhibitor that is used for the treatment of obsessive-compulsive disorder. |
|
formula |
C15H21F3N2O2 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_50949 |
|
has_exact_synonym |
(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-1-one O-(2-aminoethyl)oxime Fluvoxamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-{[(E)-{5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethan-1-amine fluvoxamine O-(2-aminoethyl)-N-{(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}hydroxylamine fluvoxamina fluvoxaminum |
|
id |
CHEBI:5138 |
|
in_subset | ||
inchi |
InChI=1S/C15H21F3N2O2/c1-21-10-3-2-4-14(20-22-11-9-19)12-5-7-13(8-6-12)15(16,17)18/h5-8H,2-4,9-11,19H2,1H3/b20-14+ |
|
inchikey |
CJOFXWAVKWHTFT-XSFVSMFZSA-N |
|
label |
fluvoxamine |
|
mass |
318.340 |
|
monoisotopicmass |
318.15551 |
|
notation |
CHEBI:5138 |
|
prefLabel |
fluvoxamine |
|
smiles |
COCCCC\C(=N/OCCN)C1=CC=C(C=C1)C(F)(F)F |
|
treeView | ||
subClassOf |