loading...| Preferred Name | felbamate | |
| Synonyms |
2-phenyl-1,3-propanediol dicarbamate carbamic acid 2-phenyltrimethylene ester felbamate felbamatum felbamato Carbamic acid 3-carbamoyloxy-2-phenyl-propyl ester Felbamate 2-phenylpropane-1,3-diyl dicarbamate |
|
| Definitions |
The bis(carbamate ester) of 2-phenylpropane-1,3-diol. An anticonvulsant, it is used in the treatment of epilepsy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4995 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C07501 Drug_Central:1140 Wikipedia:Felbamate PMID:12873507 CAS:25451-15-4 PMID:12825948 LINCS:LSM-4232 Patent:US4978680 DrugBank:DB00949 PMID:18311896 Reaxys:3345236 Patent:US2884444 KEGG:D00536 |
|
| definition |
The bis(carbamate ester) of 2-phenylpropane-1,3-diol. An anticonvulsant, it is used in the treatment of epilepsy. |
|
| formula |
C11H14N2O4 |
|
| has role | ||
| has_alternative_id |
CHEBI:250451 |
|
| has_exact_synonym |
Felbamate 2-phenylpropane-1,3-diyl dicarbamate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-phenyl-1,3-propanediol dicarbamate carbamic acid 2-phenyltrimethylene ester felbamate felbamatum felbamato Carbamic acid 3-carbamoyloxy-2-phenyl-propyl ester |
|
| id |
CHEBI:4995 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
|
| inchikey |
WKGXYQFOCVYPAC-UHFFFAOYSA-N |
|
| label |
felbamate |
|
| mass |
238.23990 |
|
| monoisotopicmass |
238.09536 |
|
| notation |
CHEBI:4995 |
|
| prefLabel |
felbamate |
|
| smiles |
NC(=O)OCC(COC(N)=O)c1ccccc1 |
|
| treeView | ||
| subClassOf |