loading...| Preferred Name | doxepin | |
| Synonyms |
3-dibenz[b,e]oxepin-11(6H)-ylidene-N,N-dimethyl-1-propanamine Doxepin 3-dibenzo[b,e]oxepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine |
|
| Definitions |
A dibenzooxepine that is 6,11-dihydrodibenzo[b,e]oxepine substituted by a 3-(dimethylamino)propylidene group at position 11. It is used as an antidepressant drug. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4710 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:1348849 LINCS:LSM-2803 DrugBank:DB01142 KEGG:C06971 PMID:19357442 Wikipedia:Doxepin HMDB:HMDB0015273 PMID:15014590 KEGG:D07875 CAS:1668-19-5 Drug_Central:956 |
|
| definition |
A dibenzooxepine that is 6,11-dihydrodibenzo[b,e]oxepine substituted by a 3-(dimethylamino)propylidene group at position 11. It is used as an antidepressant drug. |
|
| formula |
C19H21NO |
|
| has role | ||
| has_exact_synonym |
Doxepin 3-dibenzo[b,e]oxepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-dibenz[b,e]oxepin-11(6H)-ylidene-N,N-dimethyl-1-propanamine |
|
| id |
CHEBI:4710 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H21NO/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3 |
|
| inchikey |
ODQWQRRAPPTVAG-UHFFFAOYSA-N |
|
| label |
doxepin |
|
| mass |
279.37618 |
|
| monoisotopicmass |
279.16231 |
|
| notation |
CHEBI:4710 |
|
| prefLabel |
doxepin |
|
| smiles |
[H]C(CCN(C)C)=C1c2ccccc2COc2ccccc12 |
|
| treeView | ||
| subClassOf |