loading...| Preferred Name | octadecanoic acid | |
| Synonyms |
acide stearique STEARIC ACID octadecoic acid 18:0 Stearinsaeure acide octadecanoique n-octadecanoic acid Octadecansaeure Oktadekansaeure C18:0 CH3-[CH2]16-COOH stearic acid Octadecanoic acid octadecanoic acid |
|
| Definitions |
A C18 straight-chain saturated fatty acid component of many animal and vegetable lipids. As well as in the diet, it is used in hardening soaps, softening plastics and in making cosmetics, candles and plastics. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28842 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Stearic_acid Drug_Central:4611 PMID:26884207 PMID:17439666 KEGG:C01530 KEGG:D00119 PMID:16448636 KNApSAcK:C00001238 MetaCyc:STEARIC_ACID PDBeChem:STE HMDB:HMDB0000827 PMID:22735334 PMID:7763343 DrugBank:DB03193 LIPID_MAPS_instance:LMFA01010018 Reaxys:608585 CAS:57-11-4 Gmelin:11738 PMID:19468063 PMID:19838949 PMID:18982377 PMID:11425337 |
|
| definition |
A C18 straight-chain saturated fatty acid component of many animal and vegetable lipids. As well as in the diet, it is used in hardening soaps, softening plastics and in making cosmetics, candles and plastics. |
|
| formula |
C18H36O2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_83056 |
|
| has_alternative_id |
CHEBI:45710 CHEBI:25631 |
|
| has_exact_synonym |
Octadecanoic acid octadecanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
acide stearique STEARIC ACID octadecoic acid 18:0 Stearinsaeure acide octadecanoique n-octadecanoic acid Octadecansaeure Oktadekansaeure C18:0 CH3-[CH2]16-COOH stearic acid |
|
| id |
CHEBI:28842 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
|
| inchikey |
QIQXTHQIDYTFRH-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
octadecanoic acid |
|
| mass |
284.478 |
|
| monoisotopicmass |
284.27153 |
|
| notation |
CHEBI:28842 |
|
| prefLabel |
octadecanoic acid |
|
| smiles |
C(CCCCCCCCCC)CCCCCCC(=O)O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_15904 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_15904 |