Preferred Name |
guaiacol |
|
Synonyms |
2-methoxyphenol guaiacol Guaiacol 2-Hydroxyanisole 1-Hydroxy-2-methoxybenzene o-Methoxyphenol Catechol monomethyl ether |
|
Definitions |
A monomethoxybenzene that consists of phenol with a methoxy substituent at the ortho position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28591 |
|
charge |
0 |
|
database_cross_reference |
PMID:23587706 Wikipedia:Guaiacol KEGG:C15572 Reaxys:508112 KNApSAcK:C00002654 KEGG:C01502 LINCS:LSM-6001 PDBeChem:JZ3 Drug_Central:1334 PMID:22103597 Patent:RU94026717 KEGG:D00117 HMDB:HMDB0001398 PMID:24295708 MetaCyc:CPD-400 KNApSAcK:C00029459 CAS:90-05-1 |
|
definition |
A monomethoxybenzene that consists of phenol with a methoxy substituent at the ortho position. |
|
formula |
C7H8O2 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_48219 |
|
has_alternative_id |
CHEBI:24434 CHEBI:5549 |
|
has_exact_synonym |
2-methoxyphenol guaiacol Guaiacol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Hydroxyanisole 1-Hydroxy-2-methoxybenzene o-Methoxyphenol Catechol monomethyl ether |
|
id |
CHEBI:28591 |
|
in_subset | ||
inchi |
InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
|
inchikey |
LHGVFZTZFXWLCP-UHFFFAOYSA-N |
|
label |
guaiacol |
|
mass |
124.13722 |
|
monoisotopicmass |
124.05243 |
|
notation |
CHEBI:28591 |
|
prefLabel |
guaiacol |
|
smiles |
COc1ccccc1O |
|
treeView | ||
subClassOf |