loading...| Preferred Name | albuterol | |
| Synonyms |
Proventil Salbutamol 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol Albuterol |
|
| Definitions |
A member of the class of phenylethanolamines that is 4-(2-amino-1-hydroxyethyl)-2-(hydroxymethyl)phenol having a tert-butyl group attached to the nirogen atom. It acts as a beta-adrenergic agonist used in the treatment of asthma and chronic obstructive pulmonary disease (COPD). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2549 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Albuterol Reaxys:2213614 DrugBank:DB01001 LINCS:LSM-5178 Drug_Central:105 PMID:8267204 CAS:18559-94-9 HMDB:HMDB0001937 PMID:9847435 KEGG:D02147 |
|
| definition |
A member of the class of phenylethanolamines that is 4-(2-amino-1-hydroxyethyl)-2-(hydroxymethyl)phenol having a tert-butyl group attached to the nirogen atom. It acts as a beta-adrenergic agonist used in the treatment of asthma and chronic obstructive pulmonary disease (COPD). |
|
| formula |
C13H21NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35522 |
|
| has_exact_synonym |
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol Albuterol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Proventil Salbutamol |
|
| id |
CHEBI:2549 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3 |
|
| inchikey |
NDAUXUAQIAJITI-UHFFFAOYSA-N |
|
| label |
albuterol |
|
| mass |
239.31070 |
|
| monoisotopicmass |
239.15214 |
|
| notation |
CHEBI:2549 |
|
| prefLabel |
albuterol |
|
| smiles |
CC(C)(C)NCC(O)c1ccc(O)c(CO)c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50995 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 |