Jump to:
loading...| Preferred Name | lysine | |
| Synonyms |
alpha,epsilon-diaminocaproic acid Lysin K LYS 2,6-diaminohexanoic acid lysine |
|
| Definitions |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:1616991 PMID:22264337 Gmelin:279284 PMID:17439666 Wikipedia:Lysine KEGG:C16440 CAS:70-54-2 |
|
| definition |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
| formula |
C6H14N2O2 |
|
| has functional parent | ||
| has part | ||
| has role | ||
| has_exact_synonym |
2,6-diaminohexanoic acid lysine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alpha,epsilon-diaminocaproic acid Lysin K LYS |
|
| id |
CHEBI:25094 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
|
| inchikey |
KDXKERNSBIXSRK-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
lysine |
|
| mass |
146.18764 |
|
| monoisotopicmass |
146.10553 |
|
| notation |
CHEBI:25094 |
|
| prefLabel |
lysine |
|
| smiles |
NCCCCC(N)C(O)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_33704 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33704 |
Create mapping