loading...| Preferred Name | bilirubin IXalpha | |
| Synonyms |
8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-3,18-divinylbiladiene-ac-1,19(21H,24H)-dione 2,17-diethenyl-1,10,19,22,23,24-hexahydro-3,7,13,18-tetramethyl-1,19-dioxo-21H-biline-8,12-dipropanoic acid 1,10,19,22,23,24-hexahydro-2,7,13,17-tetramethyl-1,19-dioxo-3,18-divinylbiline-8,12-dipropionic acid bilirubin-IXalpha bilirubin(Z,Z) 2,7,13,17-tetramethyl-1,19-dioxo-3,18-divinyl-1,10,19,22,23,24-hexahydro-21H-biline-8,12-dipropanoic acid Bilirubin bilirubin 3,18-diethenyl-2,7,13,17-tetramethyl-1,19-dioxo-1,10,19,22,23,24-hexahydro-21H-biline-8,12-dipropanoic acid |
|
| Definitions |
A member of the class of biladienes that is a linear tetrapyrrole with the dipyrrole units being of both exovinyl and endovinyl type. A product of heme degradation, it is produced in the reticuloendothelial system by the reduction of biliverdin and transported to the liver as a complex with serum albumin. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16990 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:9587403 PMID:12799017 PMID:23768684 KNApSAcK:C00029828 Wikipedia:Bilirubin PDBeChem:BLR HMDB:HMDB0000054 PMID:18442622 PMID:30224965 PMID:8605219 Reaxys:74376 KEGG:C00486 MetaCyc:BILIRUBIN PMID:23763371 CAS:635-65-4 Gmelin:411033 |
|
| definition |
A member of the class of biladienes that is a linear tetrapyrrole with the dipyrrole units being of both exovinyl and endovinyl type. A product of heme degradation, it is produced in the reticuloendothelial system by the reduction of biliverdin and transported to the liver as a complex with serum albumin. |
|
| formula |
C33H36N4O6 |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_22586 |
|
| has_alternative_id |
CHEBI:3099 CHEBI:22870 CHEBI:13898 |
|
| has_exact_synonym |
bilirubin 3,18-diethenyl-2,7,13,17-tetramethyl-1,19-dioxo-1,10,19,22,23,24-hexahydro-21H-biline-8,12-dipropanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-3,18-divinylbiladiene-ac-1,19(21H,24H)-dione 2,17-diethenyl-1,10,19,22,23,24-hexahydro-3,7,13,18-tetramethyl-1,19-dioxo-21H-biline-8,12-dipropanoic acid 1,10,19,22,23,24-hexahydro-2,7,13,17-tetramethyl-1,19-dioxo-3,18-divinylbiline-8,12-dipropionic acid bilirubin-IXalpha bilirubin(Z,Z) 2,7,13,17-tetramethyl-1,19-dioxo-3,18-divinyl-1,10,19,22,23,24-hexahydro-21H-biline-8,12-dipropanoic acid Bilirubin |
|
| id |
CHEBI:16990 |
|
| in_subset | ||
| inchi |
InChI=1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14- |
|
| inchikey |
BPYKTIZUTYGOLE-IFADSCNNSA-N |
|
| is conjugate acid of | ||
| label |
bilirubin IXalpha |
|
| mass |
584.673 |
|
| monoisotopicmass |
584.26348 |
|
| notation |
CHEBI:16990 |
|
| prefLabel |
bilirubin IXalpha |
|
| smiles |
CC1=C(C=C)\C(NC1=O)=C\C1=C(C)C(CCC(O)=O)=C(CC2=C(CCC(O)=O)C(C)=C(N2)\C=C2/NC(=O)C(C=C)=C2C)N1 |
|
| treeView | ||
| subClassOf |