loading...| Preferred Name | beta-alanine | |
| Synonyms |
beta-aminopropionic acid H-beta-Ala-OH bAla omega-aminopropionic acid 3-Aminopropionic acid 3-aminopropanoic acid BETA-ALANINE beta-Alanine beta-alanine |
|
| Definitions |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16958 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0000056 KEGG:D07561 PMID:19239140 Reaxys:906793 DrugBank:DB03107 PMID:19955842 PMID:20386120 PMID:20199122 KNApSAcK:C00001333 KEGG:C00099 PMID:11850512 PMID:16934791 PDBeChem:BAL PMID:20479615 Wikipedia:Beta-Alanine PMID:12107759 PMID:22735334 PMID:12887142 PMID:14363188 Gmelin:49614 CAS:107-95-9 PMID:18528519 PMID:20994958 PMID:11139233 MetaCyc:B-ALANINE PMID:18613640 |
|
| definition |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
| formula |
C3H7NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_48705 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:12389 CHEBI:41050 CHEBI:22821 CHEBI:10343 |
|
| has_exact_synonym |
BETA-ALANINE beta-Alanine 3-aminopropanoic acid beta-alanine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
beta-aminopropionic acid H-beta-Ala-OH bAla omega-aminopropionic acid 3-Aminopropionic acid 3-aminopropanoic acid |
|
| id |
CHEBI:16958 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
|
| inchikey |
UCMIRNVEIXFBKS-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is tautomer of | ||
| label |
beta-alanine |
|
| mass |
89.09322 |
|
| monoisotopicmass |
89.04768 |
|
| notation |
CHEBI:16958 |
|
| prefLabel |
beta-alanine |
|
| smiles |
NCCC(O)=O |
|
| treeView | ||
| subClassOf |