loading...| Preferred Name | 17alpha-hydroxy-C21-steroid | |
| Synonyms |
a 17alpha-hydroxy-C21-steroid |
|
| Definitions |
Any C21-steroid carrying a hydroxy substituent at the 17alpha-position. Note that individual examples may have ring substituents at other positions and/or contain double bonds, aromatic A-rings, expanded/contracted rings etc., so the formula and mass may vary from that given for the generic structure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_138141 |
|
| charge |
0 |
|
| database_cross_reference |
MetaCyc:17a-hydroxy-C21-steroids |
|
| definition |
Any C21-steroid carrying a hydroxy substituent at the 17alpha-position. Note that individual examples may have ring substituents at other positions and/or contain double bonds, aromatic A-rings, expanded/contracted rings etc., so the formula and mass may vary from that given for the generic structure. |
|
| formula |
C21H36O |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
a 17alpha-hydroxy-C21-steroid |
|
| id |
CHEBI:138141 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H36O/c1-4-21(22)14-11-18-16-9-8-15-7-5-6-12-19(15,2)17(16)10-13-20(18,21)3/h15-18,22H,4-14H2,1-3H3/t15?,16?,17?,18?,19?,20?,21-/m1/s1 |
|
| inchikey |
JSIVWCLRCGAVHN-ILZKQPLKSA-N |
|
| label |
17alpha-hydroxy-C21-steroid |
|
| mass |
304.511 |
|
| monoisotopicmass |
304.27662 |
|
| notation |
CHEBI:138141 |
|
| prefLabel |
17alpha-hydroxy-C21-steroid |
|
| smiles |
C1CCCC2C1(C3C(CC2)C4C(CC3)([C@](CC4)(CC)O)C)C |
|
| treeView | ||
| subClassOf |