loading...| Preferred Name | promethazine | |
| Synonyms |
N,N,alpha-trimethyl-10H-phenothiazine-10-ethanamine promethazine prometazina 10-(2-Dimethylaminopropyl)phenothiazine promethazinum 10-[2-(dimethylamino)propyl]phenothiazine N-(2'-dimethylamino-2'-methyl)ethylphenothiazine (2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine proazamine N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine Promethazine |
|
| Definitions |
A tertiary amine that is a substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropan-2-amine moiety. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8461 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2286 KEGG:C07404 LINCS:LSM-4440 Patent:US2530451 DrugBank:DB01069 CAS:60-87-7 Gmelin:337077 KEGG:D00494 Patent:US2607773 Beilstein:88554 Wikipedia:Promethazine HMDB:HMDB0015202 Reaxys:88554 |
|
| definition |
A tertiary amine that is a substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropan-2-amine moiety. |
|
| formula |
C17H20N2S |
|
| has_exact_synonym |
N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine Promethazine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N,N,alpha-trimethyl-10H-phenothiazine-10-ethanamine promethazine prometazina 10-(2-Dimethylaminopropyl)phenothiazine promethazinum 10-[2-(dimethylamino)propyl]phenothiazine N-(2'-dimethylamino-2'-methyl)ethylphenothiazine (2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine proazamine |
|
| id |
CHEBI:8461 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
|
| inchikey |
PWWVAXIEGOYWEE-UHFFFAOYSA-N |
|
| label |
promethazine |
|
| mass |
284.42018 |
|
| monoisotopicmass |
284.13472 |
|
| notation |
CHEBI:8461 |
|
| preferred label |
promethazine |
|
| prefLabel |
promethazine |
|
| smiles |
CC(CN1c2ccccc2Sc2ccccc12)N(C)C |
|
| subClassOf |