Link to this page
Cell Culture Ontology
Last uploaded:
July 23, 2014
Jump to:
Preferred Name | butyric acid | |
Synonyms |
CH3-[CH2]2-COOH 1-butyric acid n-butyric acid acide butyrique 1-butanoic acid butanic acid ethylacetic acid propanecarboxylic acid propylformic acid acide butanoique BUTANOIC ACID 1-propanecarboxylic acid Buttersaeure n-butanoic acid butoic acid Butanoic acid 4:0 Butanoate C4:0 butanoic acid butyric acid Butyric acid |
|
Definitions |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30772 |
|
charge |
0
|
|
database_cross_reference |
Wikipedia:Butyric_acid PMID:19318247 PMID:14962641 PMID:12068484 PMID:19366864 HMDB:HMDB0000039 PMID:22038864 PMID:10736622 PMID:15810631 PMID:21699495 PMID:15938880 Reaxys:906770 PMID:22339023 PMID:11208715 MetaCyc:BUTYRIC_ACID DrugBank:DB03568 Gmelin:26242 Beilstein:906770 PMID:15809727 CAS:107-92-6 PMID:11305323 PMID:1542095 PMID:10956204 PMID:22322557 PMID:22466881 PDBeChem:BUA PMID:22194341 PMID:13678314 PMID:11201044 KNApSAcK:C00001180 PMID:19703412 PMID:11238216 KEGG:C00246 LIPID_MAPS_instance:LMFA01010004
|
|
definition |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group.
|
|
formula |
C4H8O2
|
|
has_alternative_id |
CHEBI:22948 CHEBI:41208 CHEBI:113450 CHEBI:3234
|
|
has_exact_synonym |
butanoic acid butyric acid Butyric acid
|
|
has_obo_namespace |
chebi_ontology
|
|
has_related_synonym |
CH3-[CH2]2-COOH 1-butyric acid n-butyric acid acide butyrique 1-butanoic acid butanic acid ethylacetic acid propanecarboxylic acid propylformic acid acide butanoique BUTANOIC ACID 1-propanecarboxylic acid Buttersaeure n-butanoic acid butoic acid Butanoic acid 4:0 Butanoate C4:0
|
|
id |
CHEBI:30772
|
|
in_subset | ||
inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)
|
|
inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-N
|
|
label |
butyric acid
|
|
mass |
88.10510
|
|
monoisotopicmass |
88.05243
|
|
notation |
CHEBI:30772
|
|
preferred label |
butyric acid
|
|
prefLabel |
butyric acid
|
|
smiles |
CCCC(O)=O
|
|
subClassOf |
Add comment
Delete | Subject | Author | Type | Created |
---|---|---|---|---|
No notes to display |
Create mapping