Preferred Name |
methionine |
|
Synonyms |
|
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
|
altId |
CHEBI:14590 CHEBI:25229 CHEBI:6829 |
|
Definition |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
|
InChI |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
|
InChIKey |
InChIKey=FFEARJCKVFRZRR-UHFFFAOYSA-N |
|
label |
methionine |
|
prefixIRI |
obo2:CHEBI_16811 |
|
prefLabel |
methionine |
|
SMILES |
CSCCC(N)C(O)=O |
|
Synonym |
Methionin 2-amino-4-(methylsulfanyl)butanoic acid 2-Amino-4-(methylthio)butyric acid Hmet 2-amino-4-(methylthio)butanoic acid methionine Met Racemethionine DL-Methionine alpha-amino-gamma-methylmercaptobutyric acid metionina C5H11NO2S M Methionine |
|
xref |
Wikipedia:Methionine UM-BBD:c0094 CiteXplore:16702333 KEGG DRUG:D04983 KEGG COMPOUND:59-51-8 Beilstein:636185 Reaxys:636185 CiteXplore:22264337 ChemIDplus:59-51-8 KEGG COMPOUND:C01733 NIST Chemistry WebBook:59-51-8 Gmelin:3117 CiteXplore:2543976 |
|
subClassOf |