Jump to:
loading...| Preferred Name | isotretinoin | |
| Synonyms |
|
|
| Definitions |
A retinoic acid that has formula C20H28O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6067 |
|
| alternative term |
Amnesteem isotretinoine InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8+,16-14- 13-cis-retinoic acid C20H28O2 Neovitamin A acid Claravis isotretinoin 13-RA InChIKey=SHGAZHPCJJPHSC-XFYACQKRSA-N (7E,9E,11E,13Z)-retinoic acid 13-cis-Vitamin A acid (2Z,4E6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid isotretinoinum Accutane CC(C=CC1=C(C)CCCC1(C)C)=C/C=C/C(C)=CC(O)=O isotretinoino |
|
| definition |
A retinoic acid that has formula C20H28O2. |
|
| has role | ||
| label |
isotretinoin |
|
| prefixIRI |
CHEBI:6067 |
|
| prefLabel |
isotretinoin |
|
| subClassOf |
Create mapping