Jump to:
loading...| Preferred Name |
paracetamol |
|
| Synonyms |
|
|
| Definitions |
A derivative of phenol which has an acetamido substituent located para to the phenolic -OH group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_46195 |
|
| alternative term |
Tylenol acetaminofen p-hydroxyacetanilide p-acetamidophenol p-hydroxyphenolacetamide paracetamolum CC(=O)Nc1ccc(O)cc1 Acenol paracetamol p-Acetylaminophenol 4'-hydroxyacetanilide 4-(Acetylamino)phenol C8H9NO2 p-acetaminophenol APAP 4-acetamidophenol Acetaminophen InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) Acetaminofen N-acetyl-p-aminophenol acetaminophene N-(4-hydroxyphenyl)acetamide InChIKey=RZVAJINKPMORJF-UHFFFAOYSA-N |
|
| definition |
A derivative of phenol which has an acetamido substituent located para to the phenolic -OH group. |
|
| has role | ||
| label |
paracetamol |
|
| prefixIRI |
CHEBI:46195 |
|
| prefLabel |
paracetamol |
|
| subClassOf |
Create mapping