Link to this page
BioModels Ontology
Last uploaded:
April 3, 2012
Jump to:
| Preferred Name | butyric acid | |
| Synonyms |
|
|
| Definitions |
A 4-carbon, straight-chain, saturated fatty acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30772 |
|
| alternative term |
acide butyrique butanoic acid 1-butanoic acid butoic acid BUTANOIC ACID InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) n-butyric acid 1-butyric acid InChIKey=FERIUCNNQQJTOY-UHFFFAOYSA-N Butanoic acid 1-propanecarboxylic acid Buttersaeure n-butanoic acid acide butanoique ethylacetic acid CH3-[CH2]2-COOH propylformic acid propanecarboxylic acid Butyric acid butyric acid CCCC(O)=O 4:0 butanic acid C4H8O2 C4:0
|
|
| definition |
A 4-carbon, straight-chain, saturated fatty acid.
|
|
| is conjugate acid of | ||
| label |
butyric acid
|
|
| prefixIRI |
CHEBI:30772
|
|
| prefLabel |
butyric acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping