Jump to:
loading...| Preferred Name | mechlorethamine | |
| Synonyms |
|
|
| Definitions |
A nitrogen mustard that has formula C5H11Cl2N. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28925 |
|
| alternative term |
CN(CCCl)CCCl Mechlorethamine beta,beta'-dichlorodiethyl-N-methylamine nitrogen mustard 2-chloro-N-(2-chloroethyl)-N-methylethanamine C5H11Cl2N bis(2-chloroethyl)methylamine N-methyl-bis(2-chloroethyl)amine N-methyl-bis(beta-chloroethyl)amine methylbis(beta-chloroethyl)amine InChIKey=HAWPXGHAZFHHAD-UHFFFAOYSA-N 2,2'-dichloro-N-methyldiethylamine chlormethine InChI=1S/C5H11Cl2N/c1-8(4-2-6)5-3-7/h2-5H2,1H3 methylbis(2-chloroethyl)amine bis(beta-chloroethyl)methylamine |
|
| definition |
A nitrogen mustard that has formula C5H11Cl2N. |
|
| has role | ||
| label |
mechlorethamine |
|
| prefixIRI |
CHEBI:28925 |
|
| prefLabel |
mechlorethamine |
|
| subClassOf |
Create mapping