Jump to:
loading...| Preferred Name |
menadione |
|
| Synonyms |
|
|
| Definitions |
A naphthoquinone having a methyl substituent at the 2-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28869 |
|
| alternative term |
C11H8O2 2-Methyl-1,4-naphthochinon Vitamin K3 MENADIONE InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 2-Methyl-1,4-naphthoquinone 2-methyl-1,4-naphthalenedione 2-methylnaphthalene-1,4-dione Menadione InChIKey=MJVAVZPDRWSRRC-UHFFFAOYSA-N CC1=CC(=O)c2ccccc2C1=O |
|
| definition |
A naphthoquinone having a methyl substituent at the 2-position. |
|
| label |
menadione |
|
| prefixIRI |
CHEBI:28869 |
|
| prefLabel |
menadione |
|
| subClassOf |
Create mapping