Preferred Name |
histidine |
|
Synonyms |
|
|
Definitions |
An imidazole that has formula C6H9N3O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27570 |
|
alternative term |
NC(Cc1c[nH]cn1)C(O)=O 2-amino-3-(1H-imidazol-4-yl)propanoic acid InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) alpha-Amino-1H-imidazole-4-propionic acid histidine Histidin InChIKey=HNDVDQJCIGZPNO-UHFFFAOYSA-N C6H9N3O2 Histidine histidina |
|
definition |
An imidazole that has formula C6H9N3O2. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
histidine |
|
prefixIRI |
CHEBI:27570 |
|
prefLabel |
histidine |
|
subClassOf |
Create mapping