Preferred Name | valine | |
Synonyms |
|
|
Definitions |
A branched chain amino acid that has formula C5H11NO2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27266 |
|
alternative term |
InChIKey=KZSNJWFQEVHDMF-UHFFFAOYSA-N Valin C5H11NO2 CC(C)C(N)C(O)=O InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) 2-amino-3-methylbutanoic acid valina valine Hval |
|
definition |
A branched chain amino acid that has formula C5H11NO2. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
valine |
|
prefixIRI |
CHEBI:27266 |
|
prefLabel |
valine |
|
subClassOf |
Create mapping