Preferred Name |
amoxapine |
|
Synonyms |
|
|
Definitions |
A dibenzooxazepine compound having a chloro substituent at the 2-position and a piperazin-1-yl group at the 11-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2675 |
|
alternative term |
amoxapine amoxapina 2-chloro-11-(piperazin-1-yl)dibenzo[b,f][1,4]oxazepine Desmethylloxapin amoxapinum 2-Chloro-11-(1-piperazinyl)dibenz(b,f)(1,4)oxazepine Clc1ccc2Oc3ccccc3N=C(N3CCNCC3)c2c1 InChIKey=QWGDMFLQWFTERH-UHFFFAOYSA-N C17H16ClN3O InChI=1S/C17H16ClN3O/c18-12-5-6-15-13(11-12)17(21-9-7-19-8-10-21)20-14-3-1-2-4-16(14)22-15/h1-6,11,19H,7-10H2 |
|
definition |
A dibenzooxazepine compound having a chloro substituent at the 2-position and a piperazin-1-yl group at the 11-position. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50949 http://purl.obolibrary.org/obo/CHEBI_48561 |
|
label |
amoxapine |
|
prefixIRI |
CHEBI:2675 |
|
prefLabel |
amoxapine |
|
subClassOf |
Create mapping