Jump to:
loading...| Preferred Name | L-thyroxine | |
| Synonyms |
|
|
| Definitions |
The L-enantiomer of thyroxine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18332 |
|
| alternative term |
4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine 3,3',5,5'-tetraiodo-L-thyronine Levothyroxin 3,5,3',5'-tetraiodo-L-thyronine InChIKey=XUIIKFGFIJCVMT-LBPRGKRZSA-N L-Thyroxine T4 InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 L-T4 C15H11I4NO4 N[C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(O)=O L-thyroxine 3,5,3',5'-TETRAIODO-L-THYRONINE levothyroxine O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine |
|
| definition |
The L-enantiomer of thyroxine. |
|
| has role | ||
| is conjugate acid of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-thyroxine |
|
| prefixIRI |
CHEBI:18332 |
|
| prefLabel |
L-thyroxine |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_30660 http://purl.obolibrary.org/obo/CHEBI_24863 |
Create mapping