Jump to:
loading...| Preferred Name | L-lysine | |
| Synonyms |
|
|
| Definitions |
An L-alpha-amino acid; the L-isomer of lysine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18019 |
|
| alternative term |
L-lysine (S)-lysine L-Lysine (2S)-2,6-diaminohexanoic acid InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 Lys K (S)-alpha,epsilon-diaminocaproic acid InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-N NCCCC[C@H](N)C(O)=O L-Lysin (S)-2,6-diaminohexanoic acid Lysine acid C6H14N2O2 |
|
| definition |
An L-alpha-amino acid; the L-isomer of lysine. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| label |
L-lysine |
|
| prefixIRI |
CHEBI:18019 |
|
| prefLabel |
L-lysine |
|
| subClassOf |
Create mapping