Jump to:
loading...| Preferred Name |
ferulic acid |
|
| Synonyms |
|
|
| Definitions |
A member of the ferulic acids that has formula C10H10O4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17620 |
|
| alternative term |
InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ 4-Hydroxy-3-methoxycinnamic acid (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid 3-methoxy-4-hydroxy-trans-cinnamic acid 4-hydroxy-3-methoxycinnamic acid InChIKey=KSEBMYQBYZTDHS-HWKANZROSA-N COc1cc(C=CC(O)=O)ccc1O Ferulic acid C10H10O4 |
|
| definition |
A member of the ferulic acids that has formula C10H10O4. |
|
| label |
ferulic acid |
|
| prefixIRI |
CHEBI:17620 |
|
| prefLabel |
ferulic acid |
|
| subClassOf |
Create mapping