Jump to:
loading...| Preferred Name | L-tryptophan | |
| Synonyms |
|
|
| Definitions |
The L-enantiomer of tryptophan. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16828 |
|
| alternative term |
Tryptophan InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 L-tryptophan Trp C11H12N2O2 N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O (S)-alpha-amino-1H-indole-3-propanoic acid (S)-tryptophan TRYPTOPHAN InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N (S)-alpha-Amino-beta-(3-indolyl)-propionic acid W L-beta-3-indolylalanine L-Tryptophan L-(-)-tryptophan (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
|
| definition |
The L-enantiomer of tryptophan. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-tryptophan |
|
| prefixIRI |
CHEBI:16828 |
|
| prefLabel |
L-tryptophan |
|
| subClassOf |
Create mapping