Preferred Name | tryptophan | |
Synonyms |
|
|
Definitions |
An aminoalkylindole that has formula C11H12N2O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27897 |
|
alternative term |
Tryptophan Htrp triptofano 2-amino-3-(1H-indol-3-yl)propanoic acid C11H12N2O2 InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) beta-3-indolylalanine InChIKey=QIVBCDIJIAJPQS-UHFFFAOYSA-N tryptophan alpha-Amino-beta-(3-indolyl)-propionic acid NC(Cc1c[nH]c2ccccc12)C(O)=O alpha-amino-beta-3-indolepropionic acid tryptophane |
|
definition |
An aminoalkylindole that has formula C11H12N2O2. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
tryptophan |
|
prefixIRI |
CHEBI:27897 |
|
prefLabel |
tryptophan |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33856 |
Create mapping