loading...| Preferred Name | ubiquinones | |
| Synonyms |
|
|
| Definitions |
Any benzoquinone derived from 2,3-dimethoxy-5-methylbenzoquinone; one of a group of naturally occurring homologues. The redox-active quinoid moiety usually carries a polyprenoid side chain at position 6, the number of isoprenoid units in which is species-specific. Ubiquinones are involved in the control of mitochondrial electron transport, and are also potent anti-oxidants. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16389 |
|
| alternative term |
coenzymes Q C14H18O4(C5H8)n Q mitochondrial ubiquinone Ubichinon InChI=1S/C14H18O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h6H,7H2,1-5H3 Ubiquinones CoQ Koenzym Q Ubiquinone mitochondrial ubiquinones InChIKey=SOECUQMRSRVZQQ-UHFFFAOYSA-N coenzyme Q a ubiquinone mitoquinones Coenzym Q Coenzyme Q |
|
| definition |
Any benzoquinone derived from 2,3-dimethoxy-5-methylbenzoquinone; one of a group of naturally occurring homologues. The redox-active quinoid moiety usually carries a polyprenoid side chain at position 6, the number of isoprenoid units in which is species-specific. Ubiquinones are involved in the control of mitochondrial electron transport, and are also potent anti-oxidants. |
|
| has functional parent | ||
| label |
ubiquinones |
|
| prefixIRI |
CHEBI:16389 |
|
| prefLabel |
ubiquinones |
|
| subClassOf |