Preferred Name |
tiagabine |
|
Synonyms |
(3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid (R)-(-)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid (-)-(R)-1-(4,4-bis(3-methyl-2-thienyl)-3-butenyl)nipecotic acid (-)-(R)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid (R)-tiagabine tiagabina tiagabine tiagabinum |
|
Definitions |
A piperidinemonocarboxylic acid that is (R)-nipecotic acid in which the hydrogen attached to the nitrogen has been replaced by a 1,1-bis(3-methyl-2-thienyl)but-1-en-4-yl group. A GABA reuptake inhibitor, it is used (generally as the hydrochloride salt) for the treatment of epilepsy. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9586 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Tiagabine PMID:22592677 LINCS:LSM-5700 HMDB:HMDB0015042 PMID:23770680 PMID:23997364 PMID:9097364 PMID:24440890 PMID:24500879 Reaxys:6375354 KEGG:C07503 PMID:10530690 Patent:WO8700171 PMID:9449883 PMID:25663257 CAS:115103-54-3 Patent:US5010090 KEGG:D08588 Drug_Central:2648 DrugBank:DB00906 |
|
definition |
A piperidinemonocarboxylic acid that is (R)-nipecotic acid in which the hydrogen attached to the nitrogen has been replaced by a 1,1-bis(3-methyl-2-thienyl)but-1-en-4-yl group. A GABA reuptake inhibitor, it is used (generally as the hydrochloride salt) for the treatment of epilepsy. |
|
formula |
C20H25NO2S2 |
|
has_exact_synonym |
(3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(R)-(-)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid (-)-(R)-1-(4,4-bis(3-methyl-2-thienyl)-3-butenyl)nipecotic acid (-)-(R)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid (R)-tiagabine tiagabina tiagabine tiagabinum |
|
id |
CHEBI:9586 |
|
in_subset | ||
inchi |
InChI=1S/C20H25NO2S2/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23)/t16-/m1/s1 |
|
inchikey |
PBJUNZJWGZTSKL-MRXNPFEDSA-N |
|
is_conjugate_base_of | ||
label |
tiagabine |
|
mass |
375.54800 |
|
monoisotopicmass |
375.13267 |
|
notation |
CHEBI:9586 |
|
prefLabel |
tiagabine |
|
RO_0000087 | ||
smiles |
Cc1ccsc1C(=CCCN1CCC[C@H](C1)C(O)=O)c1sccc1C |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26961 http://purl.obolibrary.org/obo/CHEBI_26148 |