loading...| Preferred Name |
sertindole |
|
| Synonyms |
1-(2-{4-[5-chloro-1-(4-fluorophenyl)-1H-indol-3-yl]piperidin-1-yl}ethyl)imidazolidin-2-one Sertindole 1-[2-[4-[5-chloro-1-(4-fluorophenyl)-indol-3-yl]-1-piperidyl]ethyl]imidazolidin-2-one sertindolum SerLect Serdolect Serlect sertindol sertindole |
|
| Definitions |
A phenylindole that is 1H-indole which is substituted on the nitrogen by a p-chlorophenyl group, at position 5 by chlorine, and at position 3 by a piperidin-4-yl group, which is itself substituted on the nitrogen by a 2-(2-oxoimidazolidin-1-yl)ethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9122 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:5364890 PMID:18484920 PMID:16317317 PMID:21080854 Wikipedia:Sertindole PMID:15461313 Drug_Central:2435 HMDB:HMDB0015618 KEGG:C07567 LINCS:LSM-5765 Reaxys:5364890 KEGG:D00561 PMID:16529528 DrugBank:DB06144 PMID:15989577 PMID:23432404 CAS:106516-24-9 PMID:9694935 |
|
| definition |
A phenylindole that is 1H-indole which is substituted on the nitrogen by a p-chlorophenyl group, at position 5 by chlorine, and at position 3 by a piperidin-4-yl group, which is itself substituted on the nitrogen by a 2-(2-oxoimidazolidin-1-yl)ethyl group. |
|
| formula |
C24H26ClFN4O |
|
| has_exact_synonym |
1-(2-{4-[5-chloro-1-(4-fluorophenyl)-1H-indol-3-yl]piperidin-1-yl}ethyl)imidazolidin-2-one Sertindole |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-[2-[4-[5-chloro-1-(4-fluorophenyl)-indol-3-yl]-1-piperidyl]ethyl]imidazolidin-2-one sertindolum SerLect Serdolect Serlect sertindol sertindole |
|
| id |
CHEBI:9122 |
|
| in_subset | ||
| inchi |
InChI=1S/C24H26ClFN4O/c25-18-1-6-23-21(15-18)22(16-30(23)20-4-2-19(26)3-5-20)17-7-10-28(11-8-17)13-14-29-12-9-27-24(29)31/h1-6,15-17H,7-14H2,(H,27,31) |
|
| inchikey |
GZKLJWGUPQBVJQ-UHFFFAOYSA-N |
|
| label |
sertindole |
|
| mass |
440.94100 |
|
| monoisotopicmass |
440.17792 |
|
| notation |
CHEBI:9122 |
|
| prefLabel |
sertindole |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48279 |
|
| smiles |
Fc1ccc(cc1)-n1cc(C2CCN(CC2)CCN2CCNC2=O)c2cc(Cl)ccc12 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_48585 http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_48559 |