loading...| Preferred Name | methyl phenyl(piperidin-2-yl)acetate | |
| Synonyms |
methyl alpha-phenyl-alpha-(2-piperidyl)acetate methylphenidan methyl phenidylacetate alpha-phenyl-2-piperidineacetic acid methyl ester methyl alpha-phenyl-alpha-2-piperidinylacetate methyl phenyl(piperidin-2-yl)acetate |
|
| Definitions |
A amino acid ester that is methyl phenylacetate in which one of the hydrogens alpha to the carbonyl group is replaced by a piperidin-2-yl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_84276 |
|
| alternative term |
methyl alpha-phenyl-alpha-(2-piperidyl)acetate methylphenidan methyl phenidylacetate alpha-phenyl-2-piperidineacetic acid methyl ester methyl alpha-phenyl-alpha-2-piperidinylacetate methyl phenyl(piperidin-2-yl)acetate |
|
| charge |
0 |
|
| definition |
A amino acid ester that is methyl phenylacetate in which one of the hydrogens alpha to the carbonyl group is replaced by a piperidin-2-yl group. |
|
| formula |
C14H19NO2 |
|
| has_exact_synonym |
methyl phenyl(piperidin-2-yl)acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
methyl alpha-phenyl-alpha-(2-piperidyl)acetate methylphenidan methyl phenidylacetate alpha-phenyl-2-piperidineacetic acid methyl ester methyl alpha-phenyl-alpha-2-piperidinylacetate |
|
| id |
CHEBI:84276 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3 |
|
| inchikey |
DUGOZIWVEXMGBE-UHFFFAOYSA-N |
|
| label |
methyl phenyl(piperidin-2-yl)acetate |
|
| mass |
233.30620 |
|
| monoisotopicmass |
233.14158 |
|
| notation |
CHEBI:84276 |
|
| prefLabel |
methyl phenyl(piperidin-2-yl)acetate |
|
| smiles |
COC(=O)C(C1CCCCN1)c1ccccc1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25248 |