Preferred Name |
levamisole |
|
Synonyms |
(6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole (-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (S)-2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole levamisolum (-)-tetramisole (S)-(-)-levamisole (S)-(-)-tetramisole Ketrax Lepuron Levomysol Levovermax Totalon Wormicid levamisol levamisole |
|
Definitions |
A 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole that has S configuration. It is used (generally as the monohydrochloride salt) to treat parasitic worm infections in pigs, sheep and cattle and was formerly used in humans as an adjuvant to chemotherapy for the treatment of various cancers. It is also widely used as an adulterant to coccaine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6432 |
|
charge |
0 |
|
database_cross_reference |
Patent:US3274209 PMID:23577329 PMID:22607692 PMID:12232676 PMID:7051554 PMID:6995094 KEGG:C07070 PMID:2050823 Drug_Central:1561 PMID:6995092 PMID:827785 HMDB:HMDB0014986 LINCS:LSM-6655 PMID:17608969 KEGG:D08114 PMID:23041983 PMID:366135 PMID:366137 CAS:14769-73-4 Wikipedia:Levamisole Patent:US3579530 PMID:1618599 PMID:23543977 PMID:15109274 PMID:22337783 PMID:23152411 PMID:24365689 DrugBank:DB00848 PMID:189006 PMID:669135 PMID:365327 PMID:23649929 Patent:US3565907 PMID:10701095 Reaxys:4233256 PMID:12749943 PMID:23921349 PMID:24440755 VSDB:1798 |
|
definition |
A 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole that has S configuration. It is used (generally as the monohydrochloride salt) to treat parasitic worm infections in pigs, sheep and cattle and was formerly used in humans as an adjuvant to chemotherapy for the treatment of various cancers. It is also widely used as an adulterant to coccaine. |
|
formula |
C11H12N2S |
|
has_exact_synonym |
(6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole (-)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (S)-2,3,5,6-tetrahydro-6-phenylimidazo[2,1-b]thiazole levamisolum (-)-tetramisole (S)-(-)-levamisole (S)-(-)-tetramisole Ketrax Lepuron Levomysol Levovermax Totalon Wormicid levamisol levamisole |
|
id |
CHEBI:6432 |
|
in_subset | ||
inchi |
InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
|
inchikey |
HLFSDGLLUJUHTE-SNVBAGLBSA-N |
|
is_enantiomer_of | ||
label |
levamisole |
|
mass |
204.29100 |
|
monoisotopicmass |
204.07212 |
|
notation |
CHEBI:6432 |
|
prefLabel |
levamisole |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50847 http://purl.obolibrary.org/obo/CHEBI_35444 |
|
smiles |
C1CN2C[C@@H](N=C2S1)c1ccccc1 |
|
subClassOf |