loading...| Preferred Name | topiramate | |
| Synonyms |
2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose sulfamate 2,3:4,5-bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamate topiramatum McN-4853 RWJ-17021 TPM Topamax tipiramate tipiramato topiramate topiramato Topiramate |
|
| Definitions |
A hexose derivative that is 2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose in which the hydroxy group has been converted to the corresponding sulfamate ester. It blocks voltage-dependent sodium channels and is used as an antiepileptic and for the prevention of migraine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63631 |
|
| alternative term |
2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose sulfamate 2,3:4,5-bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamate topiramatum McN-4853 RWJ-17021 TPM Topamax tipiramate tipiramato topiramate topiramato Topiramate |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2706 PDBeChem:TOR Wikipedia:Topiramate CAS:97240-79-4 KEGG:C07502 PMID:22233396 Reaxys:5988957 Patent:US4513006 PMID:22249827 LINCS:LSM-5435 DrugBank:DB00273 KEGG:D00537 |
|
| definition |
A hexose derivative that is 2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose in which the hydroxy group has been converted to the corresponding sulfamate ester. It blocks voltage-dependent sodium channels and is used as an antiepileptic and for the prevention of migraine. |
|
| formula |
C12H21NO8S |
|
| has_alternative_id |
CHEBI:9633 |
|
| has_exact_synonym |
Topiramate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose sulfamate 2,3:4,5-bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamate topiramatum McN-4853 RWJ-17021 TPM Topamax tipiramate tipiramato topiramate topiramato |
|
| id |
CHEBI:63631 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H21NO8S/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12/h7-9H,5-6H2,1-4H3,(H2,13,14,15)/t7-,8-,9+,12+/m1/s1 |
|
| inchikey |
KJADKKWYZYXHBB-XBWDGYHZSA-N |
|
| label |
topiramate |
|
| mass |
339.36200 |
|
| monoisotopicmass |
339.09879 |
|
| notation |
CHEBI:63631 |
|
| prefLabel |
topiramate |
|
| RO_0000087 | ||
| smiles |
CC1(C)O[C@@H]2CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@H]3[C@@H]2O1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_48199 |