Preferred Name |
sotalol |
|
Synonyms |
N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide Sotalol 4'-(1-hydroxy-2-(isopropylamino)ethyl)methane sulfonanilide beta-cardone sotalol sotalolum |
|
Definitions |
A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is substituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63622 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C07309 Wikipedia:Sotalol PMID:20562595 HMDB:HMDB0014632 PMID:21553267 CAS:3930-20-9 KEGG:D08525 Reaxys:2380820 DrugBank:DB00489 Drug_Central:2464 PMID:21854895 LINCS:LSM-1465 |
|
definition |
A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is substituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias. |
|
formula |
C12H20N2O3S |
|
has_alternative_id |
CHEBI:9206 |
|
has_exact_synonym |
N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide Sotalol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4'-(1-hydroxy-2-(isopropylamino)ethyl)methane sulfonanilide beta-cardone sotalol sotalolum |
|
id |
CHEBI:63622 |
|
in_subset | ||
inchi |
InChI=1S/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 |
|
inchikey |
ZBMZVLHSJCTVON-UHFFFAOYSA-N |
|
is_conjugate_base_of | ||
label |
sotalol |
|
mass |
272.36400 |
|
monoisotopicmass |
272.11946 |
|
notation |
CHEBI:63622 |
|
prefLabel |
sotalol |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_38070 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
smiles |
CC(C)NCC(O)c1ccc(NS(C)(=O)=O)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 http://purl.obolibrary.org/obo/CHEBI_50995 |