loading...| Preferred Name |
fenfluramine hydrochloride |
|
| Synonyms |
N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine hydrochloride N-ethyl-alpha-methyl-m-(trifluoromethyl)phenethylamine hydrochloride (+-)-fenfluramine HCl (+-)-fenfluramine hydrochloride NN-ethyl-alpha-methyl-3-trifluoromethylphenethylamine hydrochloride 1-(3-trifluoromethylphenyl)-2-ethylaminopropane hydrochloride fenfluramine HCl N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-aminium chloride |
|
| Definitions |
The hydrochloride salt of fenfluramine. It binds to the serotonin reuptake pump, causing inhbition of serotonin uptake and release of serotonin. The resulting increased levels of serotonin lead to greater serotonin receptor activation which in turn lead to enhancement of serotoninergic transmission in the centres of feeding behavior located in the hypothalamus. This suppresses the appetite for carbohydrates. Fenfluramine hydrochloride was used for treatment of diabetes and obesity. It was withdrawn worldwide after reports of heart valve disease and pulmonary hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59729 |
|
| alternative term |
N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine hydrochloride N-ethyl-alpha-methyl-m-(trifluoromethyl)phenethylamine hydrochloride (+-)-fenfluramine HCl (+-)-fenfluramine hydrochloride NN-ethyl-alpha-methyl-3-trifluoromethylphenethylamine hydrochloride 1-(3-trifluoromethylphenyl)-2-ethylaminopropane hydrochloride fenfluramine HCl N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-aminium chloride |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_50949 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:404-82-0 KEGG:D04148 Beilstein:5652886 DrugBank:DB00574 |
|
| definition |
The hydrochloride salt of fenfluramine. It binds to the serotonin reuptake pump, causing inhbition of serotonin uptake and release of serotonin. The resulting increased levels of serotonin lead to greater serotonin receptor activation which in turn lead to enhancement of serotoninergic transmission in the centres of feeding behavior located in the hypothalamus. This suppresses the appetite for carbohydrates. Fenfluramine hydrochloride was used for treatment of diabetes and obesity. It was withdrawn worldwide after reports of heart valve disease and pulmonary hypertension. |
|
| formula |
C12H17ClF3N |
|
| has part | ||
| has_exact_synonym |
N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-aminium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine hydrochloride N-ethyl-alpha-methyl-m-(trifluoromethyl)phenethylamine hydrochloride (+-)-fenfluramine HCl (+-)-fenfluramine hydrochloride NN-ethyl-alpha-methyl-3-trifluoromethylphenethylamine hydrochloride 1-(3-trifluoromethylphenyl)-2-ethylaminopropane hydrochloride fenfluramine HCl |
|
| id |
CHEBI:59729 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H16F3N.ClH/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15;/h4-6,8-9,16H,3,7H2,1-2H3;1H |
|
| inchikey |
ZXKXJHAOUFHNAS-UHFFFAOYSA-N |
|
| label |
fenfluramine hydrochloride |
|
| mass |
267.71800 |
|
| monoisotopicmass |
267.10016 |
|
| notation |
CHEBI:59729 |
|
| overlaps | ||
| prefLabel |
fenfluramine hydrochloride |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50949 |
|
| smiles |
[Cl-].CC[NH2+]C(C)Cc1cccc(c1)C(F)(F)F |
|
| subClassOf |