Preferred Name | hydrochlorothiazide | |
Synonyms |
hydrochlorothiazidum hidroclorotiazida Esidrix (TN) hydrochlorothiazide 6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
Definitions |
A benzothiadiazine that is 3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide substituted by a chloro group at position 6 and a sulfonamide at 7. It is diuretic used for the treatment of hypertension and congestive heart failure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5778 |
|
alternative term |
hydrochlorothiazidum hidroclorotiazida Esidrix (TN) hydrochlorothiazide 6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
bearer of |
http://purl.obolibrary.org/obo/CHEBI_35498 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
charge |
0 |
|
database_cross_reference |
HMDB:HMDB0001928 KEGG:C07041 PMID:24849193 CAS:58-93-5 KEGG:D00340 Drug_Central:1385 Wikipedia:Hydrochlorothiazide Reaxys:625101 PMID:24055851 PDBeChem:HCZ LINCS:LSM-5308 PMID:24657333 DrugBank:DB00999 |
|
definition |
A benzothiadiazine that is 3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide substituted by a chloro group at position 6 and a sulfonamide at 7. It is diuretic used for the treatment of hypertension and congestive heart failure. |
|
formula |
C7H8ClN3O4S2 |
|
has_exact_synonym |
6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
hydrochlorothiazidum hidroclorotiazida Esidrix (TN) hydrochlorothiazide |
|
id |
CHEBI:5778 |
|
in_subset | ||
inchi |
InChI=1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13) |
|
inchikey |
JZUFKLXOESDKRF-UHFFFAOYSA-N |
|
label |
hydrochlorothiazide |
|
mass |
297.73900 |
|
monoisotopicmass |
296.96448 |
|
notation |
CHEBI:5778 |
|
prefLabel |
hydrochlorothiazide |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35498 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
smiles |
NS(=O)(=O)c1cc2c(NCNS2(=O)=O)cc1Cl |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |