loading...| Preferred Name |
fluvoxamine |
|
| Synonyms |
(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-1-one O-(2-aminoethyl)oxime Fluvoxamine fluvoxaminum fluvoxamina fluvoxamine 2-{[(E)-{5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethan-1-amine O-(2-aminoethyl)-N-{(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}hydroxylamine |
|
| Definitions |
An oxime O-ether that is benzene substituted by a (1E)-N-(2-aminoethoxy)-5-methoxypentanimidoyl group at position 1 and a trifluoromethyl group at position 4. It is a selective serotonin reuptake inhibitor that is used for the treatment of obsessive-compulsive disorder. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5138 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:33392622 PMID:30734885 PMID:18976545 Chemspider:4481878 CAS:54739-18-3 PDBeChem:FVX KEGG:D07984 PMID:20025739 PMID:33180097 PMID:9164424 DrugBank:DB00176 Drug_Central:1230 PMID:11825104 PMID:16316311 PMID:31807102 Patent:US4085225 PMID:24121440 MetaCyc:CPD-20520 Wikipedia:Fluvoxamine PMID:30690950 Patent:NL7503310 PMID:10456487 PMID:32618683 PMID:20573265 PMID:32672818 PMID:7988100 PMID:15686112 KEGG:C07571 PMID:22859721 HMDB:HMDB0014322 Beilstein:5583954 PMID:31807753 PMID:29379174 PMID:12107854 |
|
| definition |
An oxime O-ether that is benzene substituted by a (1E)-N-(2-aminoethoxy)-5-methoxypentanimidoyl group at position 1 and a trifluoromethyl group at position 4. It is a selective serotonin reuptake inhibitor that is used for the treatment of obsessive-compulsive disorder. |
|
| formula |
C15H21F3N2O2 |
|
| has_exact_synonym |
(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-1-one O-(2-aminoethyl)oxime Fluvoxamine |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
fluvoxaminum fluvoxamina fluvoxamine 2-{[(E)-{5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethan-1-amine O-(2-aminoethyl)-N-{(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}hydroxylamine |
|
| id |
CHEBI:5138 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H21F3N2O2/c1-21-10-3-2-4-14(20-22-11-9-19)12-5-7-13(8-6-12)15(16,17)18/h5-8H,2-4,9-11,19H2,1H3/b20-14+ |
|
| inchikey |
CJOFXWAVKWHTFT-XSFVSMFZSA-N |
|
| label |
fluvoxamine |
|
| mass |
318.340 |
|
| monoisotopicmass |
318.15551 |
|
| notation |
CHEBI:5138 |
|
| prefLabel |
fluvoxamine |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50949 |
|
| smiles |
COCCCC\C(=N/OCCN)C1=CC=C(C=C1)C(F)(F)F |
|
| subClassOf |