Preferred Name | retinol | |
Synonyms |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol retinol |
|
Definitions |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraen-1-ol substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_50211 |
|
alternative term |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol retinol |
|
bearer of | ||
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5317 MetaCyc:Retinols |
|
definition |
A retinoid consisting of 3,7-dimethylnona-2,4,6,8-tetraen-1-ol substituted at position 9 by a 2,6,6-trimethylcyclohex-1-en-1-yl group (geometry of the four exocyclic double bonds is not specified). |
|
formula |
C20H30O |
|
has_alternative_id |
CHEBI:15037 CHEBI:26538 |
|
has_exact_synonym |
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol retinol |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:50211 |
|
in_subset | ||
inchi |
InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3 |
|
inchikey |
FPIPGXGPPPQFEQ-UHFFFAOYSA-N |
|
label |
retinol |
|
mass |
286.45160 |
|
monoisotopicmass |
286.22967 |
|
notation |
CHEBI:50211 |
|
prefLabel |
retinol |
|
RO_0000087 | ||
smiles |
CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CCO |
|
subClassOf |