Preferred Name | doxepin | |
Synonyms |
3-dibenz[b,e]oxepin-11(6H)-ylidene-N,N-dimethyl-1-propanamine 3-dibenzo[b,e]oxepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine Doxepin |
|
Definitions |
A dibenzooxepine that is 6,11-dihydrodibenzo[b,e]oxepine substituted by a 3-(dimethylamino)propylidene group at position 11. It is used as an antidepressant drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4710 |
|
alternative term |
3-dibenz[b,e]oxepin-11(6H)-ylidene-N,N-dimethyl-1-propanamine 3-dibenzo[b,e]oxepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine Doxepin |
|
bearer of | ||
charge |
0 |
|
database_cross_reference |
Beilstein:1348849 KEGG:D07875 HMDB:HMDB0015273 Drug_Central:956 LINCS:LSM-2803 DrugBank:DB01142 PMID:19357442 Wikipedia:Doxepin KEGG:C06971 CAS:1668-19-5 PMID:15014590 Reaxys:1348849 |
|
definition |
A dibenzooxepine that is 6,11-dihydrodibenzo[b,e]oxepine substituted by a 3-(dimethylamino)propylidene group at position 11. It is used as an antidepressant drug. |
|
formula |
C19H21NO |
|
has_exact_synonym |
3-dibenzo[b,e]oxepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine Doxepin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-dibenz[b,e]oxepin-11(6H)-ylidene-N,N-dimethyl-1-propanamine |
|
id |
CHEBI:4710 |
|
in_subset | ||
inchi |
InChI=1S/C19H21NO/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3 |
|
inchikey |
ODQWQRRAPPTVAG-UHFFFAOYSA-N |
|
label |
doxepin |
|
mass |
279.37618 |
|
monoisotopicmass |
279.16231 |
|
notation |
CHEBI:4710 |
|
prefLabel |
doxepin |
|
RO_0000087 | ||
smiles |
[H]C(CCN(C)C)=C1c2ccccc2COc2ccccc12 |
|
subClassOf |