loading...| Preferred Name | clopidogrel | |
| Synonyms |
clopidogrel (+)-Clopidogrel clopidogrelum methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate |
|
| Definitions |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group, the methylene hydrogen of which is replaced by a methoxycarbonyl group (the S enantiomer). A P2Y12 receptor antagonist, it is used to inhibit blood clots and prevent heart attacks. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_37941 |
|
| alternative term |
clopidogrel (+)-Clopidogrel clopidogrelum methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_50249 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:16802846 DrugBank:DB00758 Patent:US4847265 Patent:EP281459 Drug_Central:708 CAS:113665-84-2 Patent:US4529596 Patent:EP99802 PMID:19573725 PMID:18708826 LINCS:LSM-5415 PMID:18520712 PMID:10983738 PMID:11701941 Beilstein:8151914 Wikipedia:Clopidogrel PMID:11095576 |
|
| definition |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group, the methylene hydrogen of which is replaced by a methoxycarbonyl group (the S enantiomer). A P2Y12 receptor antagonist, it is used to inhibit blood clots and prevent heart attacks. |
|
| formula |
C16H16ClNO2S |
|
| has_exact_synonym |
methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
clopidogrel (+)-Clopidogrel clopidogrelum |
|
| id |
CHEBI:37941 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H16ClNO2S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14/h2-5,7,9,15H,6,8,10H2,1H3/t15-/m0/s1 |
|
| inchikey |
GKTWGGQPFAXNFI-HNNXBMFYSA-N |
|
| label |
clopidogrel |
|
| mass |
321.82200 |
|
| monoisotopicmass |
321.05903 |
|
| notation |
CHEBI:37941 |
|
| prefLabel |
clopidogrel |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50249 |
|
| smiles |
COC(=O)[C@@H](N1CCc2sccc2C1)c1ccccc1Cl |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 |