Preferred Name |
indole-3-acetate |
|
Synonyms |
(indol-3-yl)acetate 2-(indol-3-yl)ethanoate 1H-indol-3-ylacetate |
|
Definitions |
An indol-3-yl carboxylic acid anion that is the conjugate base of indole-3-acetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30854 |
|
alternative term |
(indol-3-yl)acetate 2-(indol-3-yl)ethanoate 1H-indol-3-ylacetate |
|
bearer of |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
charge |
-1 |
|
database_cross_reference |
Gmelin:329972 Beilstein:3906817 Reaxys:3906817 |
|
definition |
An indol-3-yl carboxylic acid anion that is the conjugate base of indole-3-acetic acid. |
|
formula |
C10H8NO2 |
|
has_alternative_id |
CHEBI:14452 CHEBI:14447 CHEBI:24801 |
|
has_exact_synonym |
1H-indol-3-ylacetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(indol-3-yl)acetate 2-(indol-3-yl)ethanoate |
|
id |
CHEBI:30854 |
|
in_subset | ||
inchi |
InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 |
|
inchikey |
SEOVTRFCIGRIMH-UHFFFAOYSA-M |
|
is_conjugate_base_of | ||
label |
indole-3-acetate |
|
mass |
174.17660 |
|
monoisotopicmass |
174.05605 |
|
notation |
CHEBI:30854 |
|
prefLabel |
indole-3-acetate |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
smiles |
[O-]C(=O)Cc1c[nH]c2ccccc12 |
|
subClassOf |