loading...| Preferred Name | thyronine | |
| Synonyms |
2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid O-(4-hydroxyphenyl)-DL-tyrosine thyronine |
|
| Definitions |
A tyrosine derivative where the phenolic hydrogen of tyrosine is substituted by 4-hydroxyphenyl. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30661 |
|
| alternative term |
2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid O-(4-hydroxyphenyl)-DL-tyrosine thyronine |
|
| charge |
0 |
|
| database_cross_reference |
PMID:15643926 Beilstein:2947040 CAS:1034-10-2 Reaxys:2947040 Gmelin:419747 |
|
| definition |
A tyrosine derivative where the phenolic hydrogen of tyrosine is substituted by 4-hydroxyphenyl. |
|
| formula |
C15H15NO4 |
|
| has_exact_synonym |
thyronine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid O-(4-hydroxyphenyl)-DL-tyrosine |
|
| id |
CHEBI:30661 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19) |
|
| inchikey |
KKCIOUWDFWQUBT-UHFFFAOYSA-N |
|
| label |
thyronine |
|
| mass |
273.28394 |
|
| monoisotopicmass |
273.10011 |
|
| notation |
CHEBI:30661 |
|
| prefLabel |
thyronine |
|
| smiles |
NC(Cc1ccc(Oc2ccc(O)cc2)cc1)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33853 |