loading...| Preferred Name | guaiacol | |
| Synonyms |
1-Hydroxy-2-methoxybenzene Catechol monomethyl ether 2-Hydroxyanisole o-Methoxyphenol 2-methoxyphenol Guaiacol guaiacol |
|
| Definitions |
A monomethoxybenzene that consists of phenol with a methoxy substituent at the ortho position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28591 |
|
| alternative term |
1-Hydroxy-2-methoxybenzene Catechol monomethyl ether 2-Hydroxyanisole o-Methoxyphenol 2-methoxyphenol Guaiacol guaiacol |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_48219 |
|
| charge |
0 |
|
| database_cross_reference |
MetaCyc:CPD-400 Patent:RU94026717 LINCS:LSM-6001 Wikipedia:Guaiacol KEGG:D00117 Reaxys:508112 KNApSAcK:C00002654 Drug_Central:1334 KEGG:C01502 PMID:23587706 PMID:24295708 KNApSAcK:C00029459 CAS:90-05-1 PMID:22103597 KEGG:C15572 PDBeChem:JZ3 HMDB:HMDB0001398 |
|
| definition |
A monomethoxybenzene that consists of phenol with a methoxy substituent at the ortho position. |
|
| formula |
C7H8O2 |
|
| has_alternative_id |
CHEBI:24434 CHEBI:5549 |
|
| has_exact_synonym |
2-methoxyphenol Guaiacol guaiacol |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-Hydroxy-2-methoxybenzene Catechol monomethyl ether 2-Hydroxyanisole o-Methoxyphenol |
|
| id |
CHEBI:28591 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
|
| inchikey |
LHGVFZTZFXWLCP-UHFFFAOYSA-N |
|
| label |
guaiacol |
|
| mass |
124.13722 |
|
| monoisotopicmass |
124.05243 |
|
| notation |
CHEBI:28591 |
|
| prefLabel |
guaiacol |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_48219 |
|
| smiles |
COc1ccccc1O |
|
| subClassOf |