Preferred Name |
methacrylate |
|
Synonyms |
2-methylprop-2-enoate methacrylate methacrylate(1-) 2-methyl-2-propenoate 2-methyl-2-propenoic acid, ion(1-) methacrylate anion |
|
Definitions |
A monocarboxylic acid anion that is obtained by removal of a proton from the carboxylic acid group of methacrylic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25218 |
|
charge |
-1 |
|
database_cross_reference |
CAS:18358-13-9 Reaxys:3587577 UM-BBD_compID:c0520 Beilstein:3587577 Gmelin:324367 |
|
definition |
A monocarboxylic acid anion that is obtained by removal of a proton from the carboxylic acid group of methacrylic acid. |
|
formula |
C4H5O2 |
|
has_exact_synonym |
2-methylprop-2-enoate methacrylate |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
methacrylate(1-) 2-methyl-2-propenoate 2-methyl-2-propenoic acid, ion(1-) methacrylate anion |
|
id |
CHEBI:25218 |
|
in_subset | ||
inchi |
InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6)/p-1 |
|
inchikey |
CERQOIWHTDAKMF-UHFFFAOYSA-M |
|
is_conjugate_base_of | ||
label |
methacrylate |
|
mass |
85.08130 |
|
monoisotopicmass |
85.02950 |
|
notation |
CHEBI:25218 |
|
prefLabel |
methacrylate |
|
smiles |
CC(=C)C([O-])=O |
|
subClassOf |