Preferred Name |
aspartic acid |
|
Synonyms |
Aspartic acid aspartic acid 2-aminobutanedioic acid DL-Aminosuccinic acid (R,S)-Aspartic acid DL-Asparagic acid (+-)-Aspartic acid Asp D |
|
Definitions |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_22660 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:774618 CAS:617-45-8 Gmelin:185140 KEGG:C16433 Wikipedia:Aspartic_acid PMID:22264337 Beilstein:774618 |
|
definition |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
|
formula |
C4H7NO4 |
|
has part | ||
has_exact_synonym |
Aspartic acid aspartic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-aminobutanedioic acid DL-Aminosuccinic acid (R,S)-Aspartic acid DL-Asparagic acid (+-)-Aspartic acid Asp D |
|
id |
CHEBI:22660 |
|
in_subset | ||
inchi |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
|
inchikey |
CKLJMWTZIZZHCS-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
label |
aspartic acid |
|
mass |
133.10272 |
|
monoisotopicmass |
133.03751 |
|
notation |
CHEBI:22660 |
|
prefLabel |
aspartic acid |
|
RO_0000087 | ||
smiles |
NC(CC(O)=O)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_66873 |