Jump to:
loading...| Preferred Name |
octadecanoate ester |
|
| Synonyms |
octadecanoate ester alkyl octadecanoate stearic acid ester octadecanoic acid ester stearate ester |
|
| Definitions |
A fatty acid ester obtained by condensation of the carboxy group of stearic acid with the hydroxy group of any alcohol or phenol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_75925 |
|
| charge |
0 |
|
| definition |
A fatty acid ester obtained by condensation of the carboxy group of stearic acid with the hydroxy group of any alcohol or phenol. |
|
| formula |
C18H35O2R |
|
| has exact synonym |
octadecanoate ester |
|
| has functional parent | ||
| has related synonym |
alkyl octadecanoate stearic acid ester octadecanoic acid ester stearate ester |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:75925 |
|
| in_subset | ||
| label |
octadecanoate ester |
|
| mass |
283.470 |
|
| monoisotopicmass |
283.26371 |
|
| notation |
CHEBI:75925 |
|
| prefLabel |
octadecanoate ester |
|
| smiles |
C(CCCCCCCCCC)CCCCCCC(=O)O* |
|
| subClassOf |
Create mapping