Preferred Name |
11-deoxycorticosterone |
|
Synonyms |
21-hydroxypregn-4-ene-3,20-dione 11-Deoxycorticosterone Reichstein's substance Q Desoxycortone 21-Hydroxy-4-pregnene-3,20-dione 4-pregnen-21-ol-3,20-dione 21-hydroxyprogesterone Kendall's desoxy compound B desoxycortone Deoxycorticosterone DESOXYCORTICOSTERONE Cortexone DOC |
|
Definitions |
A mineralocorticoid that is progesterone substituted at position 21 by a hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16973 |
|
charge |
0 |
|
database_cross_reference |
LIPID_MAPS_instance:LMST02030087 PDBeChem:1CA KEGG:D07792 Beilstein:2062123 CAS:64-85-7 Reaxys:2062123 Wikipedia:Desoxycorticosterone PMID:22770225 Drug_Central:820 MetaCyc:11-DEOXYCORTICOSTERONE KEGG:C03205 |
|
definition |
A mineralocorticoid that is progesterone substituted at position 21 by a hydroxy group. |
|
formula |
C21H30O3 |
|
has exact synonym |
21-hydroxypregn-4-ene-3,20-dione 11-Deoxycorticosterone |
|
has functional parent | ||
has related synonym |
Reichstein's substance Q Desoxycortone 21-Hydroxy-4-pregnene-3,20-dione 4-pregnen-21-ol-3,20-dione 21-hydroxyprogesterone Kendall's desoxy compound B desoxycortone Deoxycorticosterone DESOXYCORTICOSTERONE Cortexone DOC |
|
has role | ||
has_alternative_id |
CHEBI:11314 CHEBI:39642 CHEBI:86536 CHEBI:19123 CHEBI:713 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:16973 |
|
in_subset | ||
inchi |
InChI=1S/C21H30O3/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20/h11,15-18,22H,3-10,12H2,1-2H3/t15-,16-,17-,18+,20-,21-/m0/s1 |
|
inchikey |
ZESRJSPZRDMNHY-YFWFAHHUSA-N |
|
label |
11-deoxycorticosterone |
|
mass |
330.46110 |
|
monoisotopicmass |
330.21949 |
|
notation |
CHEBI:16973 |
|
prefLabel |
11-deoxycorticosterone |
|
smiles |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)C(=O)CO |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139590 http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_25354 |