loading...| Preferred Name |
pyridoxamine |
|
| Synonyms |
Pyridoxamine 4-(aminomethyl)-5-(hydroxymethyl)-2-methylpyridin-3-ol 4-(AMINOMETHYL)-5-(HYDROXYMETHYL)-2-METHYLPYRIDIN-3-OL PM |
|
| Definitions |
A monohydroxypyridine that is pyridine substituted by a hydroxy group at position 3, an aminomethyl group at position 4, a hydroxymethyl group at position 5 and a methyl group at position 2. The 4-aminomethyl form of vitamin B6, it is used (in the form of the hydrochloride salt) for treatment of diabetic nephropathy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16410 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:7710125 PMID:2580028 Gmelin:774473 FooDB:FDB021819 KNApSAcK:C00007504 PMID:19212411 PMID:23841818 PMID:15369738 Chemspider:1023 PMID:1400785 CAS:85-87-0 PMID:33665688 PDBeChem:PXM PMID:23504149 MetaCyc:PYRIDOXAMINE Reaxys:6993 Wikipedia:Pyridoxamine PMID:33535220 HMDB:HMDB0001431 KEGG:C00534 PMID:8054960 PMID:24094054 Beilstein:6993 PMID:18434162 |
|
| definition |
A monohydroxypyridine that is pyridine substituted by a hydroxy group at position 3, an aminomethyl group at position 4, a hydroxymethyl group at position 5 and a methyl group at position 2. The 4-aminomethyl form of vitamin B6, it is used (in the form of the hydrochloride salt) for treatment of diabetic nephropathy. |
|
| formula |
C8H12N2O2 |
|
| has exact synonym |
Pyridoxamine 4-(aminomethyl)-5-(hydroxymethyl)-2-methylpyridin-3-ol |
|
| has related synonym |
4-(AMINOMETHYL)-5-(HYDROXYMETHYL)-2-METHYLPYRIDIN-3-OL PM |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_38157 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_76595 |
|
| has_alternative_id |
CHEBI:26426 CHEBI:45228 CHEBI:14978 CHEBI:8669 |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:16410 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H12N2O2/c1-5-8(12)7(2-9)6(4-11)3-10-5/h3,11-12H,2,4,9H2,1H3 |
|
| inchikey |
NHZMQXZHNVQTQA-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
pyridoxamine |
|
| mass |
168.19316 |
|
| monoisotopicmass |
168.08988 |
|
| notation |
CHEBI:16410 |
|
| prefLabel |
pyridoxamine |
|
| smiles |
Cc1ncc(CO)c(CN)c1O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_27306 http://purl.obolibrary.org/obo/CHEBI_38182 |