Preferred Name |
biopterin |
|
Synonyms |
2-amino-6-(1,2-dihydroxypropyl)pteridin-4(3H)-one Biopterin 2-Amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone 2-amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone |
|
Definitions |
A pterin derivative that consists of pterin bearing amino, oxo and 1,2-dihydroxypropyl substituents at positions 2, 4 and 6 respectively. The parent of the class of biopterins; the L-erythro isomer occurs widely in nature. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15373 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Biopterin Reaxys:234314 DrugBank:DB03886 CAS:22150-76-1 PMID:22770225 KEGG:C06313 |
|
definition |
A pterin derivative that consists of pterin bearing amino, oxo and 1,2-dihydroxypropyl substituents at positions 2, 4 and 6 respectively. The parent of the class of biopterins; the L-erythro isomer occurs widely in nature. |
|
formula |
C9H11N5O3 |
|
has exact synonym |
2-amino-6-(1,2-dihydroxypropyl)pteridin-4(3H)-one Biopterin |
|
has related synonym |
2-Amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone 2-amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone |
|
has role | ||
has_alternative_id |
CHEBI:13904 CHEBI:22880 CHEBI:3107 |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:15373 |
|
in_subset | ||
inchi |
InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) |
|
inchikey |
LHQIJBMDNUYRAM-UHFFFAOYSA-N |
|
label |
biopterin |
|
mass |
237.21554 |
|
monoisotopicmass |
237.08619 |
|
notation |
CHEBI:15373 |
|
prefLabel |
biopterin |
|
smiles |
CC(O)C(O)c1cnc2nc(N)[nH]c(=O)c2n1 |
|
subClassOf |