Preferred Name | didanosine | |
Synonyms |
ddI 2,3-dideoxyinosine didanosine 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one dideoxyinosine 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol DDI 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one didanosina ddIno didanosinum 2',3'-dideoxyinosine Didanosine |
|
Definitions |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. An antiviral drug, it is used as a medication to treat HIV/AIDS. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_490877 |
|
database_cross_reference |
PMID:10386939 DrugBank:DB00900 CAS:69655-05-6 Reaxys:3619529 PMID:1619614 Drug_Central:869 Beilstein:3619529 Wikipedia:Didanosine LINCS:LSM-6017 PMID:18549801 PMID:17046264 PMID:29438107 |
|
definition |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. An antiviral drug, it is used as a medication to treat HIV/AIDS. |
|
formula |
C10H12N4O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_53756 http://purl.obolibrary.org/obo/CHEBI_35221 |
|
has_exact_synonym |
ddI 2',3'-dideoxyinosine Didanosine |
|
has_related_synonym |
ddI 2,3-dideoxyinosine didanosine 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one dideoxyinosine 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol DDI 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one didanosina ddIno didanosinum |
|
id |
CHEBI:490877 |
|
label |
didanosine |
|
notation |
CHEBI:490877 |
|
prefLabel |
didanosine |
|
smiles |
OC[C@@H]1CC[C@@H](O1)n1cnc2c1nc[nH]c2=O |
|
subClassOf |