loading...| Preferred Name | atazanavir | |
| Synonyms |
dimethyl (3S,8S,9S,12S)-9-benzyl-3,12-di-tert-butyl-8-hydroxy-4,11-dioxo-6-[4-(2-pyridyl)benzyl]-2,5,6,10,13-pentaazatetradecanedioate |
|
| Definitions |
A heavily substituted carbohydrazide that is an antiretroviral drug of the protease inhibitor (PI) class used to treat infection of human immunodeficiency virus (HIV). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_37924 |
|
| database_cross_reference |
DrugBank:DB01072 Wikipedia:Atazanavir CAS:198904-31-3 |
|
| definition |
A heavily substituted carbohydrazide that is an antiretroviral drug of the protease inhibitor (PI) class used to treat infection of human immunodeficiency virus (HIV). |
|
| has role | ||
| has_exact_synonym |
dimethyl (3S,8S,9S,12S)-9-benzyl-3,12-di-tert-butyl-8-hydroxy-4,11-dioxo-6-[4-(2-pyridyl)benzyl]-2,5,6,10,13-pentaazatetradecanedioate |
|
| label |
atazanavir |
|
| prefixIRI |
CHEBI:37924 |
|
| prefLabel |
atazanavir |
|
| smiles |
COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc1ccc(cc1)-c1ccccn1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C |
|
| subClassOf |